| Compound Information | SONAR Target prediction |
| Name: | GLUTATHIONE |
| Unique Identifier: | SPE01502248 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 290.19 g/mol |
| X log p: | -2.978 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 68.28 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 9 |
| Rotatable Bond Count: | 11 |
| Canonical Smiles: | NC(CCC(=O)NC(CS)C(=O)NCC(O)=O)C(O)=O |
| Class: | amino acid |
| Source: | plant and animal tissue |
| Reference: | Pharm Biol 11: 539 (1968) |
| Therapeutics: | antioxidant |
| Generic_name: | GLUTHATHIONE |
| Chemical_iupac_name: | GLUTHATHIONE |
| Drug_type: | Experimental |
| Drugbank_id: | EXPT01650 |
| Logp: | -0.87 +/- 0.74 |
| Drug_category: | Hematopoietic Prostagladin D Synthase inhibitor |
| Organisms_affected: | -1 |