Compound Information | SONAR Target prediction | Name: | FISETIN | Unique Identifier: | SPE01502247 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 276.157 g/mol | X log p: | 13.537 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 1 | Canonical Smiles: | Oc1ccc2C(=O)C(O)=C(Oc2c1)c1ccc(O)c(O)c1 | Class: | flavone | Source: | Rhus and Acacia spp. | Reference: | Biochem J 77: 315 (1960) | Therapeutics: | antioxidant |
Species: |
4932 |
Condition: |
SPE01500325 |
Replicates: |
2 |
Raw OD Value: r im |
0.4535±0 |
Normalized OD Score: sc h |
0.6765±0 |
Z-Score: |
-9.7484±0 |
p-Value: |
1.87475e-22 |
Z-Factor: |
0.732033 |
Fitness Defect: |
50.0284 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 2|E6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 0.00 Celcius | Date: | 2006-08-13 YYYY-MM-DD | Plate CH Control (+): | 0.0397±0.00444 | Plate DMSO Control (-): | 0.67035±0.01920 | Plate Z-Factor: | 0.8868 |
| png ps pdf |
DBLink | Rows returned: 2 | |
5281614 |
2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-chromen-4-one |
5281692 |
3,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 15563 | Additional Members: 8 | Rows returned: 2 | |
|