| Compound Information | SONAR Target prediction | | Name: | FISETIN | | Unique Identifier: | SPE01502247 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 276.157 g/mol | | X log p: | 13.537 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1ccc2C(=O)C(O)=C(Oc2c1)c1ccc(O)c(O)c1 | | Class: | flavone | | Source: | Rhus and Acacia spp. | | Reference: | Biochem J 77: 315 (1960) | | Therapeutics: | antioxidant |
| Species: |
4932 |
| Condition: |
SPE00202175 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6588±0.00756604 |
| Normalized OD Score: sc h |
1.0108±0.0231235 |
| Z-Score: |
0.3867±0.940713 |
| p-Value: |
0.536754 |
| Z-Factor: |
-7.58647 |
| Fitness Defect: |
0.6222 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SpectrumTMP | | Plate Number and Position: | 2|E6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 21.80 Celcius | | Date: | 2006-12-19 YYYY-MM-DD | | Plate CH Control (+): | 0.037825±0.00152 | | Plate DMSO Control (-): | 0.6482749999999999±0.01557 | | Plate Z-Factor: | 0.9500 |
|  png
ps
pdf |
| DBLink | Rows returned: 2 | |
| 5281614 |
2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-chromen-4-one |
| 5281692 |
3,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
| active | Cluster 15563 | Additional Members: 8 | Rows returned: 2 | |
|
