| Compound Information | SONAR Target prediction |
| Name: | ELLAGIC ACID |
| Unique Identifier: | SPE01502245 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 296.145 g/mol |
| X log p: | 5.24 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 52.6 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 8 |
| Rotatable Bond Count: | 0 |
| Canonical Smiles: | Oc1cc2C(=O)Oc3c(O)c(O)cc4C(=O)Oc(c1O)c2c34 |
| Class: | aromatic |
| Source: | widely distributed in higher plants |
| Therapeutics: | hemostatic, antineoplastic, antimutagenic |
| Found: 170 active | as graph: single | with analogs | [1] << Back 1 2 3 4 5 6 7 8 9 10 Next >> [170] |
| Species: | 4932 |
| Condition: | BIK1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.3367±0.0188798 |
| Normalized OD Score: sc h | 0.5019±0.0210695 |
| Z-Score: | -21.8307±1.09828 |
| p-Value: | 0 |
| Z-Factor: | -1.01297 |
| Fitness Defect: | INF |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 1 |
| 5281855 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 1228 | Additional Members: 2 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory