Compound Information | SONAR Target prediction | Name: | DEOXYADENOSINE | Unique Identifier: | SPE01502238 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 238.139 g/mol | X log p: | 2.791 (online calculus) | Lipinksi Failures | 0 | TPSA | 49.55 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 2 | Canonical Smiles: | Nc1ncnc2n(cnc12)C1CC(O)C(CO)O1 | Class: | alkaloid | Source: | synthetic | Generic_name: | 2--DEOXYADENOSINE | Chemical_iupac_name: | 5-(6-AMINO-PURIN-9-YL)-2-HYDROXYMETHYL-TETRAHYDRO-FURAN-3-OL | Drug_type: | Experimental | Drugbank_id: | EXPT00166 | Logp: | -1.08 | Drug_category: | Purine Trans Deoxyribosylase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
SLT2 |
Replicates: |
2 |
Raw OD Value: r im |
0.7601±0.0233345 |
Normalized OD Score: sc h |
0.8492±0.0263148 |
Z-Score: |
-4.1556±0.754661 |
p-Value: |
0.000147528 |
Z-Factor: |
-0.0335031 |
Fitness Defect: |
8.8215 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 8|A7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.10 Celcius | Date: | 2006-03-21 YYYY-MM-DD | Plate CH Control (+): | 0.038400000000000004±0.00100 | Plate DMSO Control (-): | 0.7422000000000001±0.01057 | Plate Z-Factor: | 0.9651 |
| png ps pdf |
6708685 |
(2R,3S)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
6997185 |
(2S,3S,5S)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
7059421 |
(2S,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
15276896 |
(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-2-methyl-oxolan-3-ol |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 9750 | Additional Members: 25 | Rows returned: 3 | |
|