| Compound Information | SONAR Target prediction | | Name: | DEOXYADENOSINE | | Unique Identifier: | SPE01502238 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 238.139 g/mol | | X log p: | 2.791 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 49.55 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 8 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | Nc1ncnc2n(cnc12)C1CC(O)C(CO)O1 | | Class: | alkaloid | | Source: | synthetic | | Generic_name: | 2--DEOXYADENOSINE | | Chemical_iupac_name: | 5-(6-AMINO-PURIN-9-YL)-2-HYDROXYMETHYL-TETRAHYDRO-FURAN-3-OL | | Drug_type: | Experimental | | Drugbank_id: | EXPT00166 | | Logp: | -1.08 | | Drug_category: | Purine Trans Deoxyribosylase inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
pdr_yCG196 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6255±0.013435 |
| Normalized OD Score: sc h |
0.8422±0.0247799 |
| Z-Score: |
-5.2760±0.788702 |
| p-Value: |
0.00000119179 |
| Z-Factor: |
-0.124285 |
| Fitness Defect: |
13.6401 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 19|B3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.09925±0.00547 | | Plate DMSO Control (-): | 0.9100000000000001±0.02790 | | Plate Z-Factor: | 0.8705 |
| png ps pdf |
| 636 |
5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| 13730 |
(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| 72246 |
(2R,3R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| 453553 |
(2S,3R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| 489519 |
(2S,3R,5S)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| 6541020 |
(2R,3R,5S)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| internal high similarity DBLink | Rows returned: 4 | |
|