| Compound Information | SONAR Target prediction |  | Name: | DEOXYADENOSINE |  | Unique Identifier: | SPE01502238  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 238.139 g/mol |  | X log p: | 2.791  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 49.55 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 8 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | Nc1ncnc2n(cnc12)C1CC(O)C(CO)O1 |  | Class: | alkaloid |  | Source: | synthetic |  | Generic_name: | 2--DEOXYADENOSINE |  | Chemical_iupac_name: | 5-(6-AMINO-PURIN-9-YL)-2-HYDROXYMETHYL-TETRAHYDRO-FURAN-3-OL |  | Drug_type: | Experimental |  | Drugbank_id: | EXPT00166 |  | Logp: | -1.08 |  | Drug_category: | Purine Trans Deoxyribosylase inhibitor |  | Organisms_affected: | -1 |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		BY4741-3rd | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.8650±0.00650538 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9907±0.00314665 | 
	 
	
		| Z-Score: | 
		1.2227±0.0632151 | 
	 
	
		| p-Value: | 
		0.22192 | 
	 
	
		| Z-Factor: | 
		-4.71228 | 
	 
	
		| Fitness Defect: | 
		1.5054 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum_ED |  | Plate Number and Position: | 19|B3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 595 nm |  | Robot Temperature: | 30.00 Celcius |  | Date: | 2010-08-10 YYYY-MM-DD |  | Plate CH Control (+): | 0.09499999999999999±0.00500 |  | Plate DMSO Control (-): | 0.9424999999999999±0.02843 |  | Plate Z-Factor: | 0.9030 |  
  |  png ps pdf |  
 
 
	
		| 636 | 
		5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol | 
	 
	
		| 13730 | 
		(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol | 
	 
	
		| 72246 | 
		(2R,3R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol | 
	 
	
		| 453553 | 
		(2S,3R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol | 
	 
	
		| 489519 | 
		(2S,3R,5S)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol | 
	 
	
		| 6541020 | 
		(2R,3R,5S)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol | 
	 
 
 | internal high similarity DBLink  | Rows returned: 4 |  |   
 |  active | Cluster 9750 | Additional Members: 25 | Rows returned: 3 |  |   
 
 |