| Compound Information | SONAR Target prediction |
| Name: | S-(1,2-DICARBOXYETHYL)GLUTATHIONE |
| Unique Identifier: | SPE01502216 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C15H23N3O10S |
| Molecular Weight: | 414.241 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | NC(CCC(=O)NC(CCSC(CC(O)=O)C(O)=O)C(=O)NCC(O)=O)C(O)=O |
| Source: | rat heart and liver |
| Reference: | Arzneimittel-Forsch 42:1482 (1992) |
| Therapeutics: | antiinflammatory, antiallergy, mast cell degranulation inhibitor |
