| Compound Information | SONAR Target prediction |  | Name: | TROLEANDOMYCIN |  | Unique Identifier: | SPE01502203  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 746.436 g/mol |  | X log p: | -0.425  (online calculus) |  | Lipinksi Failures | 2 |  | TPSA | 184.19 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 16 |  | Rotatable Bond Count: | 12 |  | Canonical Smiles: | COC1CC(OC(C)C1OC(C)=O)OC1C(C)C(OC2OC(C)CC(C2OC(C)=O)N(C)C)C(C)CC2(CO2) C(=O)C(C)C(OC(C)=O)C(C)C(C)OC(=O)C1C |  | Source: | semisynthetic; TAO, NSC-108166 |  | Therapeutics: | antibacterial |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		MSN5 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6828±0.00473762 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9981±0.00292299 | 
	 
	
		| Z-Score: | 
		-0.0917±0.136956 | 
	 
	
		| p-Value: | 
		0.923174 | 
	 
	
		| Z-Factor: | 
		-10.2266 | 
	 
	
		| Fitness Defect: | 
		0.0799 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 5|B2 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.50 Celcius |  | Date: | 2008-02-29 YYYY-MM-DD |  | Plate CH Control (+): | 0.040775±0.00054 |  | Plate DMSO Control (-): | 0.6716249999999999±0.01464 |  | Plate Z-Factor: | 0.9180 |  
  |  png ps pdf |  
 
 
	
		| 17675 | 
		[(2S,3S,4S,6S)-6-[[(3R,5S,6S,7R,8S,9R,12R,13S,14R,15R)-14-acetyloxy-6-[(2S,3R,4S,6R)-3-acetyloxy-4-dimet hylamino-6-methyl-oxan-2-yl]oxy-5,7,9,12,13,15-hexamethyl-10,16-dioxo-1,11-dioxaspiro[2.13]hexadec-8-yl] oxy]-4-methoxy-2-methyl-oxan-3-yl] acetate | 
	 
	
		| 202225 | 
		[(2S,3S,4S,6S)-6-[[(3R,5S,6S,7R,8S,9R,12R,13S,14S,15R)-14-acetyloxy-6-[(2S,3R,4S,6R)-3-acetyloxy-4-dimet hylamino-6-methyl-oxan-2-yl]oxy-5,7,9,12,13,15-hexamethyl-10,16-dioxo-1,11-dioxaspiro[2.13]hexadec-8-yl] oxy]-4-methoxy-2-methyl-oxan-3-yl] acetate | 
	 
	
		| 418931 | 
		[6-[[14-acetyloxy-6-(3-acetyloxy-4-dimethylamino-6-methyl-oxan-2-yl)oxy-5,7,9,12,13,15-hexamethyl-10,16- dioxo-1,11-dioxaspiro[2.13]hexadec-8-yl]oxy]-4-methoxy-2-methyl-oxan-3-yl] acetate | 
	 
	
		| 5284630 | 
		[(2S,3S,4S,6S)-6-[[(3S,5S,6S,7R,8S,9R,12R,13S,14S,15R)-14-acetyloxy-6-[(2S,3R,4S,6R)-3-acetyloxy-4-dimet hylamino-6-methyl-oxan-2-yl]oxy-5,7,9,12,13,15-hexamethyl-10,16-dioxo-1,11-dioxaspiro[2.13]hexadec-8-yl] oxy]-4-methoxy-2-methyl-oxan-3-yl] acetate | 
	 
	
		| 5289436 | 
		[(2S,3S,4S,6S)-6-[[(3R,5R,6S,7R,8S,9R,12R,13S,14R,15R)-14-acetyloxy-6-[(2S,3R,4S,6R)-3-acetyloxy-4-dimet hylamino-6-methyl-oxan-2-yl]oxy-5,7,9,12,13,15-hexamethyl-10,16-dioxo-1,11-dioxaspiro[2.13]hexadec-8-yl] oxy]-4-methoxy-2-methyl-oxan-3-yl] acetate | 
	 
	
		| 6540754 | 
		[(2S,3S,4S)-6-[[(3R,5S,6S,7R,8S,9R,12R,13S,14S,15R)-14-acetyloxy-6-[(3R,4S,6R)-3-acetyloxy-4-dimethylami no-6-methyl-oxan-2-yl]oxy-5,7,9,12,13,15-hexamethyl-10,16-dioxo-1,11-dioxaspiro[2.13]hexadec-8-yl]oxy]-4 -methoxy-2-methyl-oxan-3-yl] acetate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 1 |  |   
 |  nonactive | Cluster 2234 | Additional Members: 5 | Rows returned: 3 |  |   
 
 |