| Compound Information | SONAR Target prediction | | Name: | TROLEANDOMYCIN | | Unique Identifier: | SPE01502203 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 746.436 g/mol | | X log p: | -0.425 (online calculus) | | Lipinksi Failures | 2 | | TPSA | 184.19 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 16 | | Rotatable Bond Count: | 12 | | Canonical Smiles: | COC1CC(OC(C)C1OC(C)=O)OC1C(C)C(OC2OC(C)CC(C2OC(C)=O)N(C)C)C(C)CC2(CO2) C(=O)C(C)C(OC(C)=O)C(C)C(C)OC(=O)C1C | | Source: | semisynthetic; TAO, NSC-108166 | | Therapeutics: | antibacterial |
| Species: |
4932 |
| Condition: |
MCK1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5888±0.000424264 |
| Normalized OD Score: sc h |
0.9868±0.00525068 |
| Z-Score: |
-0.5513±0.179688 |
| p-Value: |
0.584456 |
| Z-Factor: |
-4.71123 |
| Fitness Defect: |
0.5371 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 14|E7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.60 Celcius | | Date: | 2007-11-13 YYYY-MM-DD | | Plate CH Control (+): | 0.0393±0.00087 | | Plate DMSO Control (-): | 0.5917±0.01258 | | Plate Z-Factor: | 0.9246 |
| png ps pdf |
| 17675 |
[(2S,3S,4S,6S)-6-[[(3R,5S,6S,7R,8S,9R,12R,13S,14R,15R)-14-acetyloxy-6-[(2S,3R,4S,6R)-3-acetyloxy-4-dimet hylamino-6-methyl-oxan-2-yl]oxy-5,7,9,12,13,15-hexamethyl-10,16-dioxo-1,11-dioxaspiro[2.13]hexadec-8-yl] oxy]-4-methoxy-2-methyl-oxan-3-yl] acetate |
| 202225 |
[(2S,3S,4S,6S)-6-[[(3R,5S,6S,7R,8S,9R,12R,13S,14S,15R)-14-acetyloxy-6-[(2S,3R,4S,6R)-3-acetyloxy-4-dimet hylamino-6-methyl-oxan-2-yl]oxy-5,7,9,12,13,15-hexamethyl-10,16-dioxo-1,11-dioxaspiro[2.13]hexadec-8-yl] oxy]-4-methoxy-2-methyl-oxan-3-yl] acetate |
| 418931 |
[6-[[14-acetyloxy-6-(3-acetyloxy-4-dimethylamino-6-methyl-oxan-2-yl)oxy-5,7,9,12,13,15-hexamethyl-10,16- dioxo-1,11-dioxaspiro[2.13]hexadec-8-yl]oxy]-4-methoxy-2-methyl-oxan-3-yl] acetate |
| 5284630 |
[(2S,3S,4S,6S)-6-[[(3S,5S,6S,7R,8S,9R,12R,13S,14S,15R)-14-acetyloxy-6-[(2S,3R,4S,6R)-3-acetyloxy-4-dimet hylamino-6-methyl-oxan-2-yl]oxy-5,7,9,12,13,15-hexamethyl-10,16-dioxo-1,11-dioxaspiro[2.13]hexadec-8-yl] oxy]-4-methoxy-2-methyl-oxan-3-yl] acetate |
| 5289436 |
[(2S,3S,4S,6S)-6-[[(3R,5R,6S,7R,8S,9R,12R,13S,14R,15R)-14-acetyloxy-6-[(2S,3R,4S,6R)-3-acetyloxy-4-dimet hylamino-6-methyl-oxan-2-yl]oxy-5,7,9,12,13,15-hexamethyl-10,16-dioxo-1,11-dioxaspiro[2.13]hexadec-8-yl] oxy]-4-methoxy-2-methyl-oxan-3-yl] acetate |
| 6540754 |
[(2S,3S,4S)-6-[[(3R,5S,6S,7R,8S,9R,12R,13S,14S,15R)-14-acetyloxy-6-[(3R,4S,6R)-3-acetyloxy-4-dimethylami no-6-methyl-oxan-2-yl]oxy-5,7,9,12,13,15-hexamethyl-10,16-dioxo-1,11-dioxaspiro[2.13]hexadec-8-yl]oxy]-4 -methoxy-2-methyl-oxan-3-yl] acetate |
| internal high similarity DBLink | Rows returned: 1 | |
| nonactive | Cluster 2234 | Additional Members: 5 | Rows returned: 3 | |
|