Compound Information | SONAR Target prediction | Name: | CYCLOHEXIMIDE | Unique Identifier: | SPE01502112 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 258.165 g/mol | X log p: | -0.786 (online calculus) | Lipinksi Failures | 0 | TPSA | 51.21 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 3 | Canonical Smiles: | CC1CC(C)C(=O)C(C1)C(O)CC1CC(=O)NC(=O)C1 | Source: | synthetic | Therapeutics: | protein synthesis inhibitor |
Species: |
4932 |
Condition: |
BCK1 |
Replicates: |
2 |
Raw OD Value: r im |
0.0930±0.00417193 |
Normalized OD Score: sc h |
0.0728±0.00488301 |
Z-Score: |
-18.4036±0.230023 |
p-Value: |
0 |
Z-Factor: |
0.8173 |
Fitness Defect: |
INF |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 7|B5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2010-08-10 YYYY-MM-DD | Plate CH Control (+): | 0.09475±0.00655 | Plate DMSO Control (-): | 0.9557500000000001±0.02304 | Plate Z-Factor: | 0.8724 |
| png ps pdf |
6610291 |
4-[(2S)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
7059506 |
4-[(2R)-2-[(1S,3R,5R)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
7059507 |
4-[(2R)-2-[(1S,3R,5S)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 1392 | Additional Members: 4 | Rows returned: 1 | |
|