| Compound Information | SONAR Target prediction | | Name: | CYCLOHEXIMIDE | | Unique Identifier: | SPE01502112 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 258.165 g/mol | | X log p: | -0.786 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 51.21 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CC1CC(C)C(=O)C(C1)C(O)CC1CC(=O)NC(=O)C1 | | Source: | synthetic | | Therapeutics: | protein synthesis inhibitor |
| Species: |
4932 |
| Condition: |
FUR4 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.0438±0.000353553 |
| Normalized OD Score: sc h |
0.0961±0.00190795 |
| Z-Score: |
-23.9248±4.32171 |
| p-Value: |
0 |
| Z-Factor: |
0.839269 |
| Fitness Defect: |
INF |
| Bioactivity Statement: |
Toxic |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 23|A9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.50 Celcius | | Date: | 2006-03-22 YYYY-MM-DD | | Plate CH Control (+): | 0.039675±0.00123 | | Plate DMSO Control (-): | 0.47815±0.02214 | | Plate Z-Factor: | 0.8428 |
| png ps pdf |
| 2900 |
4-[2-(3,5-dimethyl-2-oxo-cyclohexyl)-2-hydroxy-ethyl]piperidine-2,6-dione |
| 6197 |
4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
| 120760 |
4-[(2R)-2-[(1R,3S,5S)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
| 219202 |
4-[2-[(1S,3S,5S)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
| 1770295 |
4-[(2R)-2-[(1S,3S,5R)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
| 6604199 |
4-[(2R)-2-[(1R,3R,5S)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 1392 | Additional Members: 4 | Rows returned: 1 | |
|