Compound Information | SONAR Target prediction | Name: | CYCLOHEXIMIDE | Unique Identifier: | SPE01502112 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 258.165 g/mol | X log p: | -0.786 (online calculus) | Lipinksi Failures | 0 | TPSA | 51.21 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 3 | Canonical Smiles: | CC1CC(C)C(=O)C(C1)C(O)CC1CC(=O)NC(=O)C1 | Source: | synthetic | Therapeutics: | protein synthesis inhibitor |
Species: |
4932 |
Condition: |
BY4741-2nd |
Replicates: |
2 |
Raw OD Value: r im |
0.0393±0.0013435 |
Normalized OD Score: sc h |
0.0748±0.00189114 |
Z-Score: |
-37.7159±1.2647 |
p-Value: |
0 |
Z-Factor: |
0.922949 |
Fitness Defect: |
INF |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 8|G5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 21.90 Celcius | Date: | 2008-02-08 YYYY-MM-DD | Plate CH Control (+): | 0.040025000000000005±0.00065 | Plate DMSO Control (-): | 0.67395±0.01675 | Plate Z-Factor: | 0.8985 |
| png ps pdf |
2900 |
4-[2-(3,5-dimethyl-2-oxo-cyclohexyl)-2-hydroxy-ethyl]piperidine-2,6-dione |
6197 |
4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
120760 |
4-[(2R)-2-[(1R,3S,5S)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
219202 |
4-[2-[(1S,3S,5S)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
1770295 |
4-[(2R)-2-[(1S,3S,5R)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
6604199 |
4-[(2R)-2-[(1R,3R,5S)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 1392 | Additional Members: 4 | Rows returned: 1 | |
|