| Compound Information | SONAR Target prediction |
| Name: | DEOXYGUANOSINE |
| Unique Identifier: | SPE01502110 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C10H13N5O4 |
| Molecular Weight: | 254.138 g/mol |
| X log p: | 0.677 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 54.26 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 9 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | NC1NC(=O)c2ncn(C3CC(O)C(CO)O3)c2N=1 |
| Source: | component of DNA |
| Reference: | Adv Carbohydr Chem 17: 301 (1962) |
| Found: 37 active | as graph: single | with analogs | [1] << Back 31 32 33 34 35 36 37 Next >> [37] |
| Species: | 4932 |
| Condition: | TIF3 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.2280±0.0249609 |
| Normalized OD Score: sc h | 0.3702±0.0377799 |
| Z-Score: | -29.6044±2.62514 |
| p-Value: | 0 |
| Z-Factor: | -0.497479 |
| Fitness Defect: | INF |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 2 |
| SPE03100024 | 0.9259 |
| HTS 11476 | 0.9615 |
| active | Cluster 13033 | Additional Members: 5 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory