| 
 | Compound Information | SONAR Target prediction |  | Name: | ANTIMYCIN A (A1 shown) |  | Unique Identifier: | SPE01502108 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C27H38N2O9 |  | Molecular Weight: | 496.297 g/mol |  | X log p: | 8.094  (online calculus) |  | Lipinksi Failures | 3 |  | TPSA | 113.04 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 11 |  | Rotatable Bond Count: | 13 |  | Canonical Smiles: | CCCCCC1C(OC(=O)CC(C)C)C(C)OC(=O)C(NC(=O)c2cccc(NC=O)c2O)C(C)OC1=O |  | Source: | ex Streptomyces spp |  | Therapeutics: | antifungal, antiviral, interferes in cytochrome oxidation | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SPE00200033 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6655±0 |  
		| Normalized OD Score: sc h | 0.9454±0 |  
		| Z-Score: | -1.6312±0 |  
		| p-Value: | 0.102847 |  
		| Z-Factor: | -1.0898 |  
		| Fitness Defect: | 2.2745 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 2|E4 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 0 nm |  | Robot Temperature: | 0.00 Celcius |  | Date: | 2006-08-13 YYYY-MM-DD |  | Plate CH Control (+): | 0.0412±0.00326 |  | Plate DMSO Control (-): | 0.69195±0.02390 |  | Plate Z-Factor: | 0.8741 | 
 |  png ps
 pdf
 | 
 
 
	
		| 2204 | [3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-8-pentyl-1,5-dioxonan-7-yl] 3-methylbutanoate
 |  
		| 10652 | [(6S,7S,8R)-8-butyl-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate
 |  
		| 12550 | [3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate
 |  
		| 14957 | [(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7 -yl] 3-methylbutanoate
 |  
		| 245869 | [(2R,3S,6S,7R,8R)-8-butyl-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7 -yl] 3-methylbutanoate
 |  
		| 447434 | [(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7 -yl] 2-methylpropanoate
 |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | active | Cluster 5241 | Additional Members: 4 | Rows returned: 0 |  | 
 
 |