Compound Information | SONAR Target prediction | Name: | ANTIMYCIN A (A1 shown) | Unique Identifier: | SPE01502108 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C27H38N2O9 | Molecular Weight: | 496.297 g/mol | X log p: | 8.094 (online calculus) | Lipinksi Failures | 3 | TPSA | 113.04 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 11 | Rotatable Bond Count: | 13 | Canonical Smiles: | CCCCCC1C(OC(=O)CC(C)C)C(C)OC(=O)C(NC(=O)c2cccc(NC=O)c2O)C(C)OC1=O | Source: | ex Streptomyces spp | Therapeutics: | antifungal, antiviral, interferes in cytochrome oxidation |
Species: |
4932 |
Condition: |
IRE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6743±0.00890955 |
Normalized OD Score: sc h |
0.9028±0.00659831 |
Z-Score: |
-3.0711±0.259811 |
p-Value: |
0.00250974 |
Z-Factor: |
-0.312346 |
Fitness Defect: |
5.9876 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 14|G6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.50 Celcius | Date: | 2007-11-23 YYYY-MM-DD | Plate CH Control (+): | 0.03995±0.00055 | Plate DMSO Control (-): | 0.7053750000000001±0.01295 | Plate Z-Factor: | 0.9399 |
| png ps pdf |
2204 |
[3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-8-pentyl-1,5-dioxonan-7-yl] 3-methylbutanoate |
10652 |
[(6S,7S,8R)-8-butyl-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate |
12550 |
[3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate |
14957 |
[(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7 -yl] 3-methylbutanoate |
245869 |
[(2R,3S,6S,7R,8R)-8-butyl-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7 -yl] 3-methylbutanoate |
447434 |
[(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7 -yl] 2-methylpropanoate |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 5241 | Additional Members: 4 | Rows returned: 0 | |
|