| Compound Information | SONAR Target prediction | | Name: | ANTIMYCIN A (A1 shown) | | Unique Identifier: | SPE01502108 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C27H38N2O9 | | Molecular Weight: | 496.297 g/mol | | X log p: | 8.094 (online calculus) | | Lipinksi Failures | 3 | | TPSA | 113.04 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 11 | | Rotatable Bond Count: | 13 | | Canonical Smiles: | CCCCCC1C(OC(=O)CC(C)C)C(C)OC(=O)C(NC(=O)c2cccc(NC=O)c2O)C(C)OC1=O | | Source: | ex Streptomyces spp | | Therapeutics: | antifungal, antiviral, interferes in cytochrome oxidation |
| Species: |
4932 |
| Condition: |
TMP24 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6929±0 |
| Normalized OD Score: sc h |
0.9373±0 |
| Z-Score: |
-1.2586±0 |
| p-Value: |
0.208194 |
| Z-Factor: |
-0.235838 |
| Fitness Defect: |
1.5693 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SpectrumTMP | | Plate Number and Position: | 2|E4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 36.90 Celcius | | Date: | 2006-08-08 YYYY-MM-DD | | Plate CH Control (+): | 0.0405±0.00071 | | Plate DMSO Control (-): | 0.81115±0.01900 | | Plate Z-Factor: | 0.9228 |
| png ps pdf |
| 2204 |
[3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-8-pentyl-1,5-dioxonan-7-yl] 3-methylbutanoate |
| 10652 |
[(6S,7S,8R)-8-butyl-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate |
| 12550 |
[3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate |
| 14957 |
[(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7 -yl] 3-methylbutanoate |
| 245869 |
[(2R,3S,6S,7R,8R)-8-butyl-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7 -yl] 3-methylbutanoate |
| 447434 |
[(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7 -yl] 2-methylpropanoate |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 5241 | Additional Members: 4 | Rows returned: 0 | |
|