| Compound Information | SONAR Target prediction | | Name: | ANTIMYCIN A (A1 shown) | | Unique Identifier: | SPE01502108 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C27H38N2O9 | | Molecular Weight: | 496.297 g/mol | | X log p: | 8.094 (online calculus) | | Lipinksi Failures | 3 | | TPSA | 113.04 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 11 | | Rotatable Bond Count: | 13 | | Canonical Smiles: | CCCCCC1C(OC(=O)CC(C)C)C(C)OC(=O)C(NC(=O)c2cccc(NC=O)c2O)C(C)OC1=O | | Source: | ex Streptomyces spp | | Therapeutics: | antifungal, antiviral, interferes in cytochrome oxidation |
| Species: |
4932 |
| Condition: |
SPE00210025 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.0565±0.00219203 |
| Normalized OD Score: sc h |
1.0820±0.0734692 |
| Z-Score: |
0.6300±0.543955 |
| p-Value: |
0.55821 |
| Z-Factor: |
-2.97938 |
| Fitness Defect: |
0.583 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SpectrumTMP | | Plate Number and Position: | 2|E4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 22.30 Celcius | | Date: | 2006-12-12 YYYY-MM-DD | | Plate CH Control (+): | 0.0402±0.00114 | | Plate DMSO Control (-): | 0.058575±0.27364 | | Plate Z-Factor: | -2.5856 |
|  png
ps
pdf |
| 2204 |
[3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-8-pentyl-1,5-dioxonan-7-yl]
3-methylbutanoate |
| 10652 |
[(6S,7S,8R)-8-butyl-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl]
3-methylbutanoate |
| 12550 |
[3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl]
3-methylbutanoate |
| 14957 |
[(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7
-yl] 3-methylbutanoate |
| 245869 |
[(2R,3S,6S,7R,8R)-8-butyl-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7
-yl] 3-methylbutanoate |
| 447434 |
[(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7
-yl] 2-methylpropanoate |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 5241 | Additional Members: 4 | Rows returned: 0 | |
|
