| Compound Information | SONAR Target prediction | | Name: | ANTIMYCIN A (A1 shown) | | Unique Identifier: | SPE01502108 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C27H38N2O9 | | Molecular Weight: | 496.297 g/mol | | X log p: | 8.094 (online calculus) | | Lipinksi Failures | 3 | | TPSA | 113.04 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 11 | | Rotatable Bond Count: | 13 | | Canonical Smiles: | CCCCCC1C(OC(=O)CC(C)C)C(C)OC(=O)C(NC(=O)c2cccc(NC=O)c2O)C(C)OC1=O | | Source: | ex Streptomyces spp | | Therapeutics: | antifungal, antiviral, interferes in cytochrome oxidation |
| Species: |
4932 |
| Condition: |
pdr_yCG196 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6310±0.00707107 |
| Normalized OD Score: sc h |
0.8481±0.00370892 |
| Z-Score: |
-5.0822±0.162613 |
| p-Value: |
0.000000440676 |
| Z-Factor: |
0.274067 |
| Fitness Defect: |
14.635 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 19|A3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.09925±0.00547 | | Plate DMSO Control (-): | 0.9100000000000001±0.02790 | | Plate Z-Factor: | 0.8705 |
|  png
ps
pdf |
| 7067443 |
[(2S,3R,6S,7S,8S)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7
-yl] 3-methylbutanoate |
| 7067444 |
[(2S,3R,6S,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7
-yl] 3-methylbutanoate |
| 7067445 |
[(2S,3R,6S,7R,8S)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7
-yl] 3-methylbutanoate |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 5241 | Additional Members: 4 | Rows returned: 0 | |
|
