Compound Information | SONAR Target prediction | Name: | ANTIMYCIN A (A1 shown) | Unique Identifier: | SPE01502108 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C27H38N2O9 | Molecular Weight: | 496.297 g/mol | X log p: | 8.094 (online calculus) | Lipinksi Failures | 3 | TPSA | 113.04 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 11 | Rotatable Bond Count: | 13 | Canonical Smiles: | CCCCCC1C(OC(=O)CC(C)C)C(C)OC(=O)C(NC(=O)c2cccc(NC=O)c2O)C(C)OC1=O | Source: | ex Streptomyces spp | Therapeutics: | antifungal, antiviral, interferes in cytochrome oxidation |
Species: |
4932 |
Condition: |
HOG1 |
Replicates: |
2 |
Raw OD Value: r im |
0.3950±0.00282843 |
Normalized OD Score: sc h |
0.7770±0.0559214 |
Z-Score: |
-6.2757±2.56533 |
p-Value: |
0.00000406566 |
Z-Factor: |
-0.389936 |
Fitness Defect: |
12.4129 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 19|A3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2010-08-10 YYYY-MM-DD | Plate CH Control (+): | 0.08549999999999999±0.00250 | Plate DMSO Control (-): | 0.6507499999999999±0.02815 | Plate Z-Factor: | 0.7899 |
| png ps pdf |
447892 |
[(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-8-pentyl-1,5-dioxonan- 7-yl] 2-methylpropanoate |
3084471 |
[3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] butanoate |
3084472 |
[8-butyl-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] butanoate |
4587175 |
[8-butyl-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate |
5287676 |
[(2S,3S,6R,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-8-pentyl-1,5-dioxonan- 7-yl] 3-methylbutanoate |
5287683 |
[(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-heptyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan- 7-yl] (2R)-2-methylbutanoate |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 5241 | Additional Members: 4 | Rows returned: 0 | |
|