Compound Information | SONAR Target prediction | Name: | METAMPICILLIN SODIUM | Unique Identifier: | SPE01502034 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 365.255 g/mol | X log p: | 9.03 (online calculus) | Lipinksi Failures | 1 | TPSA | 115.17 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 7 | Rotatable Bond Count: | 6 | Canonical Smiles: | [Na+].[O-]C(=O)C1N2C(SC1(C)C)C(NC(=O)C(N=C)c1ccccc1)C2=O | Source: | semisynthetic | Therapeutics: | antibacterial |
Species: |
4932 |
Condition: |
MKK1 |
Replicates: |
2 |
Raw OD Value: r im |
0.8440±0.0254558 |
Normalized OD Score: sc h |
1.0042±0.0119252 |
Z-Score: |
0.1307±0.347392 |
p-Value: |
0.807576 |
Z-Factor: |
-34.2864 |
Fitness Defect: |
0.2137 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 22|E5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2010-08-10 YYYY-MM-DD | Plate CH Control (+): | 0.09075±0.00752 | Plate DMSO Control (-): | 0.9630000000000001±0.02354 | Plate Z-Factor: | 0.9097 |
| png ps pdf |
DBLink | Rows returned: 6 | |
4083 |
3,3-dimethyl-6-[[2-(methylideneamino)-2-phenyl-acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-c arboxylate |
4084 |
3,3-dimethyl-6-[[2-(methylideneamino)-2-phenyl-acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-c arboxylic acid |
5702187 |
sodium 3,3-dimethyl-6-[[2-(methylideneamino)-2-phenyl-acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-c arboxylate |
6604508 |
sodium (2S,5R,6R)-3,3-dimethyl-6-[[(2S)-2-(methylideneamino)-2-phenyl-acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3 .2.0]heptane-2-carboxylate |
6604509 |
(2S,5R,6R)-3,3-dimethyl-6-[[(2S)-2-(methylideneamino)-2-phenyl-acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3 .2.0]heptane-2-carboxylic acid |
6713928 |
(2S,5R,6R)-3,3-dimethyl-6-[[(2R)-2-(methylideneamino)-2-phenyl-acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3 .2.0]heptane-2-carboxylic acid |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 3276 | Additional Members: 16 | Rows returned: 1 | |
|