| Compound Information | SONAR Target prediction |
| Name: | ENALAPRIL MALEATE |
| Unique Identifier: | SPE01501214 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 460.265 g/mol |
| X log p: | 9.372 (online calculus) |
| Lipinksi Failures | 2 |
| TPSA | 63.68 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 7 |
| Rotatable Bond Count: | 11 |
| Canonical Smiles: | CCOC(=O)C(CCc1ccccc1)NC(C)C(=O)N1CCCC1C(O)=O.OC(=O)C=CC(O)=O |
| Source: | synthetic |
| Therapeutics: | ACE inhibitor, antihypertensive |
| Found: 205 nonactive as graph: single | with analogs | [1] << Back 1 2 3 4 5 6 7 8 9 10 Next >> [205] |
| Species: | 4932 |
| Condition: | HOG1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7540±0.0325269 |
| Normalized OD Score: sc h | 1.0468±0.00121658 |
| Z-Score: | 1.2886±0.181465 |
| p-Value: | 0.20123 |
| Z-Factor: | -1.83052 |
| Fitness Defect: | 1.6033 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 4 |
| 5388961 | but-2-enedioic acid; (2S)-1-[(2S)-2-[[(1S)-1-ethoxycarbonyl-3-phenyl-propyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
| 5462344 | but-2-enedioic acid; (2S)-1-[(2S)-2-[[(1S)-1-ethoxycarbonyl-3-phenyl-propyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
| 6435926 | but-2-enedioic acid; (2S)-1-[(2S)-2-[[(1R)-1-ethoxycarbonyl-3-phenyl-propyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
| 6526385 | but-2-enedioic acid; (2S)-1-[(2S)-2-[[(1S)-1-ethoxycarbonyl-3-phenyl-propyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
| internal high similarity DBLink | Rows returned: 0 |
| nonactive | Cluster 1273 | Additional Members: 7 | Rows returned: 6 |
| SPE01503076 | 0.388235294117647 |
| Prest197 | 0.358024691358025 |
| SPE01505212 | 0.311688311688312 |
| SPE01505264 | 0.0821917808219178 |
| Prest232 | 0 |
| SPE01505214 | 0 |
Service provided by the
Mike Tyers Laboratory