Compound Information | SONAR Target prediction | Name: | HUMULENE (alpha) | Unique Identifier: | SPE01501210 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 180.161 g/mol | X log p: | 8.455 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 0 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC=C(C)CC=CC(C)(C)CC=1 | Class: | sesquiterpene | Source: | hops and clove oils | Reference: | JACS 99: 3864 (1977); J Chem Soc 1980: 311 |
Species: |
4932 |
Condition: |
BCK1 |
Replicates: |
2 |
Raw OD Value: r im |
0.9380±0.00961665 |
Normalized OD Score: sc h |
0.9625±0.00497637 |
Z-Score: |
-3.3063±0.0387801 |
p-Value: |
0.000949708 |
Z-Factor: |
0.378805 |
Fitness Defect: |
6.9594 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 18|H11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2010-08-10 YYYY-MM-DD | Plate CH Control (+): | 0.09075±0.00653 | Plate DMSO Control (-): | 0.9639999999999999±0.02179 | Plate Z-Factor: | 0.8749 |
| png ps pdf |
23204 |
2,6,6,9-tetramethylcycloundeca-1,4,8-triene |
328948 |
2,6,6,9,13-pentamethylcyclopentadeca-1,4,8,12-tetraene |
5281520 |
(1Z,4E,8Z)-2,6,6,9-tetramethylcycloundeca-1,4,8-triene |
5318101 |
(1Z,4E,8Z)-2,6,6,9-tetramethylcycloundeca-1,4,8-triene |
5320698 |
(1Z,4E,7Z)-1,7-dimethylcyclodeca-1,4,7-triene |
5367625 |
(2Z,5E,9E)-3,12-diethyltetradeca-2,5,9-triene |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 1210 | Additional Members: 1 | Rows returned: 0 | |
|