| 
 | Compound Information | SONAR Target prediction |  | Name: | HUMULENE (alpha) |  | Unique Identifier: | SPE01501210 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 180.161 g/mol |  | X log p: | 8.455  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 0 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 0 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC1CCC=C(C)CC=CC(C)(C)CC=1 |  | Class: | sesquiterpene |  | Source: | hops and clove oils |  | Reference: | JACS 99: 3864 (1977); J Chem Soc 1980: 311 | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SPE01503602 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.5060±0 |  
		| Normalized OD Score: sc h | 0.7020±0 |  
		| Z-Score: | -2.6025±0 |  
		| p-Value: | 0.00925422 |  
		| Z-Factor: | 0.737317 |  
		| Fitness Defect: | 4.6827 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 2|D10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 0 nm |  | Robot Temperature: | 0.00 Celcius |  | Date: | 2006-08-13 YYYY-MM-DD |  | Plate CH Control (+): | 0.041±0.00142 |  | Plate DMSO Control (-): | 0.738±0.01904 |  | Plate Z-Factor: | 0.9117 | 
 |  png ps
 pdf
 | 
 
 
	
		| 23204 | 2,6,6,9-tetramethylcycloundeca-1,4,8-triene |  
		| 328948 | 2,6,6,9,13-pentamethylcyclopentadeca-1,4,8,12-tetraene |  
		| 5281520 | (1Z,4E,8Z)-2,6,6,9-tetramethylcycloundeca-1,4,8-triene |  
		| 5318101 | (1Z,4E,8Z)-2,6,6,9-tetramethylcycloundeca-1,4,8-triene |  
		| 5320698 | (1Z,4E,7Z)-1,7-dimethylcyclodeca-1,4,7-triene |  
		| 5367625 | (2Z,5E,9E)-3,12-diethyltetradeca-2,5,9-triene |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | active | Cluster 1210 | Additional Members: 1 | Rows returned: 0 |  | 
 
 |