| Compound Information | SONAR Target prediction |  | Name: | HUMULENE (alpha) |  | Unique Identifier: | SPE01501210  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 180.161 g/mol |  | X log p: | 8.455  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 0 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 0 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC1CCC=C(C)CC=CC(C)(C)CC=1 |  | Class: | sesquiterpene |  | Source: | hops and clove oils |  | Reference: | JACS 99: 3864 (1977); J Chem Soc 1980: 311 |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SPE01503640 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6386±0.0458912 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9915±0.0262821 | 
	 
	
		| Z-Score: | 
		-0.1683±0.501147 | 
	 
	
		| p-Value: | 
		0.726802 | 
	 
	
		| Z-Factor: | 
		-6.93439 | 
	 
	
		| Fitness Defect: | 
		0.3191 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 2|D10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.10 Celcius |  | Date: | 2006-11-22 YYYY-MM-DD |  | Plate CH Control (+): | 0.0392±0.00192 |  | Plate DMSO Control (-): | 0.6557±0.05407 |  | Plate Z-Factor: | 0.6865 |  
  |  png ps pdf |  
 
 
	
		| 23204 | 
		2,6,6,9-tetramethylcycloundeca-1,4,8-triene | 
	 
	
		| 328948 | 
		2,6,6,9,13-pentamethylcyclopentadeca-1,4,8,12-tetraene | 
	 
	
		| 5281520 | 
		(1Z,4E,8Z)-2,6,6,9-tetramethylcycloundeca-1,4,8-triene | 
	 
	
		| 5318101 | 
		(1Z,4E,8Z)-2,6,6,9-tetramethylcycloundeca-1,4,8-triene | 
	 
	
		| 5320698 | 
		(1Z,4E,7Z)-1,7-dimethylcyclodeca-1,4,7-triene | 
	 
	
		| 5367625 | 
		(2Z,5E,9E)-3,12-diethyltetradeca-2,5,9-triene | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 1210 | Additional Members: 1 | Rows returned: 0 |  |  
  
 |