Compound Information | SONAR Target prediction | Name: | HUMULENE (alpha) | Unique Identifier: | SPE01501210 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 180.161 g/mol | X log p: | 8.455 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 0 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC=C(C)CC=CC(C)(C)CC=1 | Class: | sesquiterpene | Source: | hops and clove oils | Reference: | JACS 99: 3864 (1977); J Chem Soc 1980: 311 |
Species: |
4932 |
Condition: |
SER1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5104±0.0301227 |
Normalized OD Score: sc h |
0.8653±0.0152202 |
Z-Score: |
-4.2367±0.363146 |
p-Value: |
0.0000379792 |
Z-Factor: |
-3.31309 |
Fitness Defect: |
10.1785 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 9|F11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.80 Celcius | Date: | 2007-09-17 YYYY-MM-DD | Plate CH Control (+): | 0.0399±0.00047 | Plate DMSO Control (-): | 0.589025±0.06861 | Plate Z-Factor: | 0.5839 |
| png ps pdf |
5384142 |
(1Z,4E,8Z,12Z)-2,6,6,9,13-pentamethylcyclopentadeca-1,4,8,12-tetraene |
6187145 |
(1E,4E,8Z)-2,6,6,9-tetramethylcycloundeca-1,4,8-triene |
6508206 |
(1Z,4E,8Z)-2,6,6,9-tetramethylcycloundeca-1,4,8-triene |
6511487 |
(1Z,4E,8Z,12Z)-2,6,6,9,13-pentamethylcyclopentadeca-1,4,8,12-tetraene |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 1210 | Additional Members: 1 | Rows returned: 0 | |
|