| Compound Information | SONAR Target prediction | | Name: | HUMULENE (alpha) | | Unique Identifier: | SPE01501210 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 180.161 g/mol | | X log p: | 8.455 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 0 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC1CCC=C(C)CC=CC(C)(C)CC=1 | | Class: | sesquiterpene | | Source: | hops and clove oils | | Reference: | JACS 99: 3864 (1977); J Chem Soc 1980: 311 |
| Species: |
4932 |
| Condition: |
SPE00201185 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4674±0.0234759 |
| Normalized OD Score: sc h |
0.8186±0.0272037 |
| Z-Score: |
-6.7729±1.14228 |
| p-Value: |
0.0000000012219 |
| Z-Factor: |
0.019658 |
| Fitness Defect: |
20.5229 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SpectrumTMP | | Plate Number and Position: | 2|D10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 21.70 Celcius | | Date: | 2006-12-15 YYYY-MM-DD | | Plate CH Control (+): | 0.0397±0.00161 | | Plate DMSO Control (-): | 0.594±0.02021 | | Plate Z-Factor: | 0.8848 |
|  png
ps
pdf |
| 5384142 |
(1Z,4E,8Z,12Z)-2,6,6,9,13-pentamethylcyclopentadeca-1,4,8,12-tetraene |
| 6187145 |
(1E,4E,8Z)-2,6,6,9-tetramethylcycloundeca-1,4,8-triene |
| 6508206 |
(1Z,4E,8Z)-2,6,6,9-tetramethylcycloundeca-1,4,8-triene |
| 6511487 |
(1Z,4E,8Z,12Z)-2,6,6,9,13-pentamethylcyclopentadeca-1,4,8,12-tetraene |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 1210 | Additional Members: 1 | Rows returned: 0 | |
|
