Compound Information | SONAR Target prediction |
Name: | LAPACHOL |
Unique Identifier: | SPE01501204 |
MolClass: | Checkout models in ver1.5 and ver1.0 |
Molecular Formula: | |
Molecular Weight: | 228.159 g/mol |
X log p: | 10.414 (online calculus) |
Lipinksi Failures | 1 |
TPSA | 34.14 |
Hydrogen Bond Donor Count: | 0 |
Hydrogen Bond Acceptors Count: | 3 |
Rotatable Bond Count: | 2 |
Canonical Smiles: | CC(C)=CCc1c(O)c(=O)c2ccccc2c1=O |
Class: | quinone |
Source: | heartwood of Bignoniaceae |
Reference: | Phytochemistry 14: 1829 (1975) |
Therapeutics: | antineoplastic, antifungal |