| Compound Information | SONAR Target prediction |
| Name: | LAPACHOL |
| Unique Identifier: | SPE01501204 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 228.159 g/mol |
| X log p: | 10.414 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 34.14 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 3 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | CC(C)=CCc1c(O)c(=O)c2ccccc2c1=O |
| Class: | quinone |
| Source: | heartwood of Bignoniaceae |
| Reference: | Phytochemistry 14: 1829 (1975) |
| Therapeutics: | antineoplastic, antifungal |
| Found: 493 nonactive | as graph: single | with analogs | [1] << Back 1 2 3 4 5 6 7 8 9 10 Next >> [493] |
| Species: | 4932 |
| Condition: | MT2481-pdr1pdr3-2nd |
| Replicates: | 2 |
| Raw OD Value: r im | 0.5217±0.00509117 |
| Normalized OD Score: sc h | 0.9160±0.00560102 |
| Z-Score: | -3.6971±0.0619094 |
| p-Value: | 0.000221094 |
| Z-Factor: | -2.50426 |
| Fitness Defect: | 8.4169 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 1 |
| 3884 | 4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 16242 | Additional Members: 2 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory