| Compound Information | SONAR Target prediction |  | Name: | FLUMETHASONE |  | Unique Identifier: | SPE01501196  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 382.229 g/mol |  | X log p: | 4.43  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 34.14 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | CC1CC2C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)CO |  | Source: | semisynthetic |  | Therapeutics: | antiinflammatory |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		ROM2 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6819±0.00325269 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0148±0.00480742 | 
	 
	
		| Z-Score: | 
		0.6555±0.234238 | 
	 
	
		| p-Value: | 
		0.51789 | 
	 
	
		| Z-Factor: | 
		-4.81256 | 
	 
	
		| Fitness Defect: | 
		0.658 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 23|C11 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.80 Celcius |  | Date: | 2007-11-21 YYYY-MM-DD |  | Plate CH Control (+): | 0.040825±0.00119 |  | Plate DMSO Control (-): | 0.655675±0.02088 |  | Plate Z-Factor: | 0.8935 |  
  |  png ps pdf |  
 
 
	
		| 3375 | 
		6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclo penta[a]phenanthren-3-one | 
	 
	
		| 16490 | 
		(6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl- 6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one | 
	 
	
		| 71415 | 
		(6S,8S,9R,10S,11S,13S,14S,16S,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl- 6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one | 
	 
	
		| 101859 | 
		(6S,8S,9R,10S,11S,13S,14S,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,11 ,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one | 
	 
	
		| 494039 | 
		6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopent a[a]phenanthren-3-one | 
	 
	
		| 5702178 | 
		(6S,9R,10S,11S,13S,16R,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,1 1,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 9739 | Additional Members: 15 | Rows returned: 1 |  |   
 
 |