Compound Information | SONAR Target prediction | Name: | FLUMETHASONE | Unique Identifier: | SPE01501196 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 382.229 g/mol | X log p: | 4.43 (online calculus) | Lipinksi Failures | 0 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC1CC2C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)CO | Source: | semisynthetic | Therapeutics: | antiinflammatory |
Species: |
4932 |
Condition: |
ARL3 |
Replicates: |
2 |
Raw OD Value: r im |
0.6544±0.00685894 |
Normalized OD Score: sc h |
0.9891±0.00677843 |
Z-Score: |
-0.5235±0.343757 |
p-Value: |
0.611236 |
Z-Factor: |
-6.56176 |
Fitness Defect: |
0.4923 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 19|F9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.00 Celcius | Date: | 2008-06-11 YYYY-MM-DD | Plate CH Control (+): | 0.0405±0.00081 | Plate DMSO Control (-): | 0.66225±0.01225 | Plate Z-Factor: | 0.9312 |
| png ps pdf |
6454069 |
(6R,8S,10S,11S,13S,14S,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,11,12 ,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
6454086 |
(6R,8S,10S,11S,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7 ,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
6604306 |
(6S,8S,9S,10R,11R,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl- 6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
6713129 |
(8R,9S,10R,11S,13S,14S,17S)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,11,12 ,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 9739 | Additional Members: 15 | Rows returned: 1 | |
|