| Compound Information | SONAR Target prediction | | Name: | ESTRADIOL-3-SULFATE, SODIUM SALT | | Unique Identifier: | SPE01501192 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 351.245 g/mol | | X log p: | 4.808 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 74.81 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | [Na+].[O-]S(=O)(=O)Oc1ccc2C3CCC4(C)C(O)CCC4C3CCc2c1 | | Source: | semisynthetic | | Therapeutics: | estrogen |
| Species: |
4932 |
| Condition: |
VID30 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6487±0.0101823 |
| Normalized OD Score: sc h |
0.9811±0.0120115 |
| Z-Score: |
-0.9148±0.592491 |
| p-Value: |
0.401118 |
| Z-Factor: |
-4.81484 |
| Fitness Defect: |
0.9135 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 8|H5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.30 Celcius | | Date: | 2007-12-05 YYYY-MM-DD | | Plate CH Control (+): | 0.04085±0.00120 | | Plate DMSO Control (-): | 0.6413±0.01176 | | Plate Z-Factor: | 0.9335 |
| png ps pdf |
| 1654 |
17-hydroxy-13-methyl-3-sulfonatooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| 1655 |
17-hydroxy-13-methyl-3-sulfooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| 21098 |
sodium (8S,9S,13S,14S,17S)-17-hydroxy-13-methyl-3-sulfonatooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a] phenanthrene |
| 66416 |
(8S,9S,13S,14S,17S)-17-hydroxy-13-methyl-3-sulfooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phen anthrene |
| 5387930 |
(8S,13S,17S)-17-hydroxy-13-methyl-3-sulfooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren e |
| 5702176 |
sodium (13S,17R)-17-hydroxy-13-methyl-3-sulfonatooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthre ne |
| internal high similarity DBLink | Rows returned: 0 | |
|