| Compound Information | SONAR Target prediction |  | Name: | ESTRADIOL-3-SULFATE, SODIUM SALT |  | Unique Identifier: | SPE01501192  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 351.245 g/mol |  | X log p: | 4.808  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 74.81 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | [Na+].[O-]S(=O)(=O)Oc1ccc2C3CCC4(C)C(O)CCC4C3CCc2c1 |  | Source: | semisynthetic |  | Therapeutics: | estrogen |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		CHS5 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7396±0.00162635 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9874±0.000472045 | 
	 
	
		| Z-Score: | 
		-0.6130±0.0393191 | 
	 
	
		| p-Value: | 
		0.54003 | 
	 
	
		| Z-Factor: | 
		-3.20342 | 
	 
	
		| Fitness Defect: | 
		0.6161 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 14|G11 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.80 Celcius |  | Date: | 2006-03-28 YYYY-MM-DD |  | Plate CH Control (+): | 0.038599999999999995±0.00138 |  | Plate DMSO Control (-): | 0.74525±0.01110 |  | Plate Z-Factor: | 0.9580 |  
  |  png ps pdf |  
 
 
	
		| 1654 | 
		17-hydroxy-13-methyl-3-sulfonatooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene | 
	 
	
		| 1655 | 
		17-hydroxy-13-methyl-3-sulfooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene | 
	 
	
		| 21098 | 
		sodium (8S,9S,13S,14S,17S)-17-hydroxy-13-methyl-3-sulfonatooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a] phenanthrene | 
	 
	
		| 66416 | 
		(8S,9S,13S,14S,17S)-17-hydroxy-13-methyl-3-sulfooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phen anthrene | 
	 
	
		| 5387930 | 
		(8S,13S,17S)-17-hydroxy-13-methyl-3-sulfooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren e | 
	 
	
		| 5702176 | 
		sodium (13S,17R)-17-hydroxy-13-methyl-3-sulfonatooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthre ne | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 3283 | Additional Members: 12 | Rows returned: 8 | 1 2 Next >>  |   
 
 |