Compound Information | SONAR Target prediction | Name: | ESTRADIOL-3-SULFATE, SODIUM SALT | Unique Identifier: | SPE01501192 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 351.245 g/mol | X log p: | 4.808 (online calculus) | Lipinksi Failures | 0 | TPSA | 74.81 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 2 | Canonical Smiles: | [Na+].[O-]S(=O)(=O)Oc1ccc2C3CCC4(C)C(O)CCC4C3CCc2c1 | Source: | semisynthetic | Therapeutics: | estrogen |
Species: |
4932 |
Condition: |
FAA2 |
Replicates: |
2 |
Raw OD Value: r im |
0.6719±0.00240416 |
Normalized OD Score: sc h |
0.9860±0.00160947 |
Z-Score: |
-0.7699±0.0335635 |
p-Value: |
0.441462 |
Z-Factor: |
-2.30705 |
Fitness Defect: |
0.8177 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 8|H5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.40 Celcius | Date: | 2008-05-27 YYYY-MM-DD | Plate CH Control (+): | 0.040325±0.00050 | Plate DMSO Control (-): | 0.662075±0.01036 | Plate Z-Factor: | 0.9374 |
| png ps pdf |
6330874 |
(8S,13S,17S)-17-hydroxy-13-methyl-3-sulfooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren e; sodium |
6398673 |
(13S,17R)-17-hydroxy-13-methyl-3-sulfooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
6453286 |
sodium (13S,17R)-13-methyl-3-sulfooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-olate |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 3283 | Additional Members: 12 | Rows returned: 8 | 1 2 Next >> |
|