| 
 | Compound Information | SONAR Target prediction |  | Name: | ESTRADIOL-3-SULFATE, SODIUM SALT |  | Unique Identifier: | SPE01501192 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 351.245 g/mol |  | X log p: | 4.808  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 74.81 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | [Na+].[O-]S(=O)(=O)Oc1ccc2C3CCC4(C)C(O)CCC4C3CCc2c1 |  | Source: | semisynthetic |  | Therapeutics: | estrogen | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SPT3 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.4797±0.0172534 |  
		| Normalized OD Score: sc h | 0.9066±0.0132009 |  
		| Z-Score: | -1.1033±0.115625 |  
		| p-Value: | 0.271502 |  
		| Z-Factor: | -0.354783 |  
		| Fitness Defect: | 1.3038 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 8|H5 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.50 Celcius |  | Date: | 2008-02-13 YYYY-MM-DD |  | Plate CH Control (+): | 0.04105±0.00091 |  | Plate DMSO Control (-): | 0.478575±0.01445 |  | Plate Z-Factor: | 0.9048 | 
 |  png ps
 pdf
 | 
 
 
	
		| 1654 | 17-hydroxy-13-methyl-3-sulfonatooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |  
		| 1655 | 17-hydroxy-13-methyl-3-sulfooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |  
		| 21098 | sodium (8S,9S,13S,14S,17S)-17-hydroxy-13-methyl-3-sulfonatooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]
 phenanthrene
 |  
		| 66416 | (8S,9S,13S,14S,17S)-17-hydroxy-13-methyl-3-sulfooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phen anthrene
 |  
		| 5387930 | (8S,13S,17S)-17-hydroxy-13-methyl-3-sulfooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren e
 |  
		| 5702176 | sodium (13S,17R)-17-hydroxy-13-methyl-3-sulfonatooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthre
 ne
 |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | active | Cluster 3283 | Additional Members: 12 | Rows returned: 8 | 1 2 Next >> | 
 
 |