| Compound Information | SONAR Target prediction |  | Name: | ESTRADIOL DIACETATE |  | Unique Identifier: | SPE01501180  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 328.233 g/mol |  | X log p: | 7.051  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 52.6 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | CC(=O)OC1CCC2C3CCc4cc(OC(C)=O)ccc4C3CCC12C |  | Source: | semisynthetic |  | Reference: | Helv Chim Acta 20: 263, 1237 (1937); Biochem J 32: 1273 (1938) ; Arch Exp Pathol PharmaKol 220: 378 (1953) |  | Therapeutics: | estrogen |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		CKA2 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.8029±0.00346482 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9374±0.000445484 | 
	 
	
		| Z-Score: | 
		-2.2523±0.118901 | 
	 
	
		| p-Value: | 
		0.0248056 | 
	 
	
		| Z-Factor: | 
		-9.62563 | 
	 
	
		| Fitness Defect: | 
		3.6967 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 15|A7 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.50 Celcius |  | Date: | 2006-04-03 YYYY-MM-DD |  | Plate CH Control (+): | 0.038125000000000006±0.00225 |  | Plate DMSO Control (-): | 0.8332999999999999±0.08722 |  | Plate Z-Factor: | 0.6217 |  
  |  png ps pdf |  
 
 
	
		| 3264 | 
		(3-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) acetate | 
	 
	
		| 66431 | 
		[(8S,9S,13S,14S,17S)-3-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1 7-yl] acetate | 
	 
	
		| 249700 | 
		(3-acetyloxy-13-methyl-17-propyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl) acetate | 
	 
	
		| 251111 | 
		[(8S,9S,13S,14S,17S)-3-acetyloxy-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthr en-17-yl] acetate | 
	 
	
		| 266197 | 
		(3-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl) acetate | 
	 
	
		| 3494502 | 
		(3-acetyloxy-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl) acetate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 1 |  |   
 |  active | Cluster 3283 | Additional Members: 12 | Rows returned: 7 | 1 2 Next >>  |   
 
 |