| Compound Information | SONAR Target prediction | | Name: | ESTRADIOL DIACETATE | | Unique Identifier: | SPE01501180 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 328.233 g/mol | | X log p: | 7.051 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 52.6 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(=O)OC1CCC2C3CCc4cc(OC(C)=O)ccc4C3CCC12C | | Source: | semisynthetic | | Reference: | Helv Chim Acta 20: 263, 1237 (1937); Biochem J 32: 1273 (1938) ; Arch Exp Pathol PharmaKol 220: 378 (1953) | | Therapeutics: | estrogen |
| Species: |
4932 |
| Condition: |
BY4741-3rd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6694±0.0126572 |
| Normalized OD Score: sc h |
0.9609±0.00534226 |
| Z-Score: |
-1.1395±0.15571 |
| p-Value: |
0.25736 |
| Z-Factor: |
-3.54495 |
| Fitness Defect: |
1.3573 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 15|A7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.50 Celcius | | Date: | 2007-09-25 YYYY-MM-DD | | Plate CH Control (+): | 0.0401±0.00079 | | Plate DMSO Control (-): | 0.68345±0.02252 | | Plate Z-Factor: | 0.8592 |
| png ps pdf |
| 3264 |
(3-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) acetate |
| 66431 |
[(8S,9S,13S,14S,17S)-3-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1 7-yl] acetate |
| 249700 |
(3-acetyloxy-13-methyl-17-propyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl) acetate |
| 251111 |
[(8S,9S,13S,14S,17S)-3-acetyloxy-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthr en-17-yl] acetate |
| 266197 |
(3-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl) acetate |
| 3494502 |
(3-acetyloxy-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl) acetate |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 3283 | Additional Members: 12 | Rows returned: 7 | 1 2 Next >> |
|