Compound Information | SONAR Target prediction | Name: | ESTRIOL METHYL ETHER | Unique Identifier: | SPE01501178 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 276.202 g/mol | X log p: | 6.939 (online calculus) | Lipinksi Failures | 1 | TPSA | 9.23 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 1 | Canonical Smiles: | COc1ccc2C3CCC4(C)C(O)C(O)CC4C3CCc2c1 | Source: | semisynthetic | Reference: | J Steroid Biochem 20: 945 (1984) | Therapeutics: | estrogen |
Species: |
4932 |
Condition: |
CHS3 |
Replicates: |
2 |
Raw OD Value: r im |
0.6519±0.0039598 |
Normalized OD Score: sc h |
0.9881±0.0097097 |
Z-Score: |
-0.5494±0.434441 |
p-Value: |
0.600158 |
Z-Factor: |
-5.72783 |
Fitness Defect: |
0.5106 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 6|E11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.30 Celcius | Date: | 2008-06-20 YYYY-MM-DD | Plate CH Control (+): | 0.040525±0.00033 | Plate DMSO Control (-): | 0.6461250000000001±0.01674 | Plate Z-Factor: | 0.9090 |
| png ps pdf |
15121 |
(16R,17R)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16,17-diol |
21185 |
(16S,17R)-3-methoxy-13,16-dimethyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene-16,17-dio l |
23434 |
(16R,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16,17-diol |
225728 |
3-methoxy-13,16-dimethyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene-16,17-diol |
242862 |
(8S,9S,13S,14S,16S,17R)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene -16,17-diol |
242863 |
(8S,9S,13S,14S,16S,17R)-16-ethyl-3-methoxy-13-methyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phen anthrene-16,17-diol |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 3283 | Additional Members: 12 | Rows returned: 7 | 1 2 Next >> |
|