| Compound Information | SONAR Target prediction | 
| Name: | FLURANDRENOLIDE | 
| Unique Identifier: | SPE01501175  | 
| MolClass: |  Checkout models in ver1.5 and ver1.0 | 
| Molecular Formula: |  | 
| Molecular Weight: | 403.252 g/mol | 
| X log p: | -0.441  (online calculus) | 
| Lipinksi Failures | 0 | 
| TPSA | 52.6 | 
| Hydrogen Bond Donor Count: | 0 | 
| Hydrogen Bond Acceptors Count: | 6 | 
| Rotatable Bond Count: | 2 | 
| Canonical Smiles: | CC1(C)OC2CC3C4CC(F)C5=CC(=O)CCC5(C)C4C(O)CC3(C)C2(O1)C(=O)CO | 
| Source: | semisynthetic | 
| Therapeutics: | antiinflammatory | 
| Generic_name: | Flurandrenolide | 
| Chemical_iupac_name: | 6-fluoro-11,21 dihydroxy-16,17-[(l-methylethylidene) bis (oxy)]-, (6?, 11?, 16?)- Pregn-4-ene-3,20-dione | 
| Drug_type: | Approved Drug | 
| Pharmgkb_id: | PA449680 | 
| Kegg_compound_id: | D00328 | 
| Drugbank_id: | APRD00982 | 
| Melting_point: | 251 oC | 
| H2o_solubility: | Insoluble | 
| Logp: | 2.887 | 
| Cas_registry_number: | 1524-88-5 | 
| Drug_category: | Anti-Inflammatory Agents; Glucocorticoids | 
| Indication: | For relief of the inflammatory and pruritic manifestations of corticosteroid-responsive dermatoses, particularly dry, scaling localized lesions | 
| Organisms_affected: | Humans and other mammals |