| Compound Information | SONAR Target prediction | | Name: | ACETAMINOSALOL | | Unique Identifier: | SPE01501170 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 258.165 g/mol | | X log p: | 16.685 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 43.37 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CC(=O)Nc1ccc(OC(=O)c2ccccc2O)cc1 | | Source: | synthetic | | Therapeutics: | analgesic, antipyretic |
| Species: |
4932 |
| Condition: |
REF2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.3986±0.0172534 |
| Normalized OD Score: sc h |
1.1523±0.00693008 |
| Z-Score: |
4.3735±0.154386 |
| p-Value: |
0.0000137079 |
| Z-Factor: |
-0.106633 |
| Fitness Defect: |
11.1975 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 3|A8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.50 Celcius | | Date: | 2008-08-27 YYYY-MM-DD | | Plate CH Control (+): | 0.04165±0.00084 | | Plate DMSO Control (-): | 0.332175±0.01561 | | Plate Z-Factor: | 0.8715 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 1984 |
(4-acetamidophenyl) 2-hydroxybenzoate |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 7758 | Additional Members: 5 | Rows returned: 0 | |
|
