| Compound Information | SONAR Target prediction |  | Name: | ACETAMINOSALOL |  | Unique Identifier: | SPE01501170  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 258.165 g/mol |  | X log p: | 16.685  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 43.37 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 5 |  | Canonical Smiles: | CC(=O)Nc1ccc(OC(=O)c2ccccc2O)cc1 |  | Source: | synthetic |  | Therapeutics: | analgesic, antipyretic |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		CHS5 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7265±0.0292742 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9590±0.0291096 | 
	 
	
		| Z-Score: | 
		-2.0072±1.46542 | 
	 
	
		| p-Value: | 
		0.166937 | 
	 
	
		| Z-Factor: | 
		-2.27267 | 
	 
	
		| Fitness Defect: | 
		1.7901 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 15|E6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.80 Celcius |  | Date: | 2006-03-28 YYYY-MM-DD |  | Plate CH Control (+): | 0.039775±0.00166 |  | Plate DMSO Control (-): | 0.7373±0.01030 |  | Plate Z-Factor: | 0.9554 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 1 |  |  
 
	
		| 1984 | 
		(4-acetamidophenyl) 2-hydroxybenzoate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 7758 | Additional Members: 5 | Rows returned: 0 |  |  
  
 |