| Compound Information | SONAR Target prediction | | Name: | ACETAMINOSALOL | | Unique Identifier: | SPE01501170 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 258.165 g/mol | | X log p: | 16.685 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 43.37 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CC(=O)Nc1ccc(OC(=O)c2ccccc2O)cc1 | | Source: | synthetic | | Therapeutics: | analgesic, antipyretic |
| Species: |
4932 |
| Condition: |
APC9 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6558±0.00296985 |
| Normalized OD Score: sc h |
0.9428±0.00727346 |
| Z-Score: |
-3.1122±0.442063 |
| p-Value: |
0.00286558 |
| Z-Factor: |
-0.740855 |
| Fitness Defect: |
5.855 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 15|E6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.30 Celcius | | Date: | 2007-11-22 YYYY-MM-DD | | Plate CH Control (+): | 0.041499999999999995±0.00060 | | Plate DMSO Control (-): | 0.6844250000000001±0.01761 | | Plate Z-Factor: | 0.9130 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 1984 |
(4-acetamidophenyl) 2-hydroxybenzoate |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 7758 | Additional Members: 5 | Rows returned: 0 | |
|