| Compound Information | SONAR Target prediction | | Name: | ACETAMINOSALOL | | Unique Identifier: | SPE01501170 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 258.165 g/mol | | X log p: | 16.685 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 43.37 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CC(=O)Nc1ccc(OC(=O)c2ccccc2O)cc1 | | Source: | synthetic | | Therapeutics: | analgesic, antipyretic |
| Species: |
4932 |
| Condition: |
SEC66 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5719±0.0113844 |
| Normalized OD Score: sc h |
0.9924±0.0244017 |
| Z-Score: |
-0.2745±0.904894 |
| p-Value: |
0.537684 |
| Z-Factor: |
-81.6672 |
| Fitness Defect: |
0.6205 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 3|A8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.00 Celcius | | Date: | 2007-12-07 YYYY-MM-DD | | Plate CH Control (+): | 0.04392499999999999±0.00057 | | Plate DMSO Control (-): | 0.55375±0.02175 | | Plate Z-Factor: | 0.8926 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 1984 |
(4-acetamidophenyl) 2-hydroxybenzoate |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 7758 | Additional Members: 5 | Rows returned: 0 | |
|