Compound Information | SONAR Target prediction | Name: | ACETAMINOSALOL | Unique Identifier: | SPE01501170 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 258.165 g/mol | X log p: | 16.685 (online calculus) | Lipinksi Failures | 1 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 5 | Canonical Smiles: | CC(=O)Nc1ccc(OC(=O)c2ccccc2O)cc1 | Source: | synthetic | Therapeutics: | analgesic, antipyretic |
Species: |
4932 |
Condition: |
SPE00203029 |
Replicates: |
2 |
Raw OD Value: r im |
0.5920±0.00735391 |
Normalized OD Score: sc h |
1.0117±0.0179753 |
Z-Score: |
0.4757±0.725157 |
p-Value: |
0.646682 |
Z-Factor: |
-213.883 |
Fitness Defect: |
0.4359 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 2|D5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 21.60 Celcius | Date: | 2006-12-19 YYYY-MM-DD | Plate CH Control (+): | 0.039349999999999996±0.00233 | Plate DMSO Control (-): | 0.5735±0.02348 | Plate Z-Factor: | 0.8799 |
| png ps pdf |
DBLink | Rows returned: 1 | |
1984 |
(4-acetamidophenyl) 2-hydroxybenzoate |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 7758 | Additional Members: 5 | Rows returned: 0 | |
|