| Compound Information | SONAR Target prediction | | Name: | MEMANTINE HYDROCHLORIDE | | Unique Identifier: | SPE01501121 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 193.588 g/mol | | X log p: | -0.844 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | Cl.CC12CC3CC(C)(C1)CC(N)(C3)C2 | | Source: | synthetic | | Therapeutics: | muscle relaxant (skeletal) | | Generic_name: | Memantine | | Chemical_iupac_name: | 3,5-dimethyladamantan-1-amine | | Drug_type: | Approved Drug | | Pharmgkb_id: | PA10364 | | Kegg_compound_id: | C13736 | | Drugbank_id: | APRD00221 | | Melting_point: | 258 oC (HCl salt) | | H2o_solubility: | 35 mg/mL (HCl salt), 0.9 mg/mL for free base | | Logp: | 2.197 | | Cas_registry_number: | 19982-08-2 | | Drug_category: | Dopamine Agents; Antiparkinson Agents; Antidyskinetics; Excitatory Amino Acid Antagonists; Central Nervous System Agents; ATC:N06DX01 | | Indication: | For the treatment of moderate to severe dementia of the Alzheimer-s type. | | Pharmacology: | Memantine, an amantadine derivative, is an NMDA receptor antagonist used in the treatment of Alzheimer-s disease. It differs from traditional agents used in Alzheimer-s disease by acting on glutamatergic neurotransmission, rather than cholinergic. There is some evidence that dysfunction of glutamatergic neurotransmission, manifested as neuronal excitotoxicity, is involved in the aetiology of Alzheimer-s disease (Cacabelos et al., 1999). As such, targeting the glutamatergic system, specifically NMDA receptors, was a novel approach to treatment in view of the limited efficacy of existing drugs targeting the cholinergic system. A systematic review of randomised controlled trials found that memantine has a positive effect on cognition, mood, behaviour, and the ability to perform daily activities. There is no evidence that memantine prevents or slows neurodegeneration in patients with Alzheimer-s disease. | | Mechanism_of_action: | Memantine exerts its action through uncompetitive NMDA receptor antagonism, binding preferentially to the NMDA receptor-operated cation channels. Prolonged increased levels of glutamate in the brain of demented patients are sufficient to counter the voltage-dependent block of NMDA receptors by Mg2+ ions and allow continuous influx of Ca2+ ions into cells and ultimately neuronal degeneration. Studies suggest that memantine binds more effectively than Mg2+ ions at the NMDA receptor, and thereby effectively blocks this prolonged influx of Ca2+ ions through the NMDA channel whilst preserving the transient physiological activation of the channels by higher concentrations of synaptically released glutamate. Thus memantine protects against chronically elevated concentrations of glutamate. | | Organisms_affected: | Humans and other mammals |
| Species: |
4932 |
| Condition: |
SWE1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7146±0.00459619 |
| Normalized OD Score: sc h |
1.0070±0.00702884 |
| Z-Score: |
0.6540±0.157256 |
| p-Value: |
0.5157 |
| Z-Factor: |
-1.93556 |
| Fitness Defect: |
0.6622 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 5|G8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.60 Celcius | | Date: | 2008-05-13 YYYY-MM-DD | | Plate CH Control (+): | 0.04044999999999999±0.00065 | | Plate DMSO Control (-): | 0.6953999999999999±0.02337 | | Plate Z-Factor: | 0.8722 |
| png ps pdf |
| 7016127 |
2-cyclopentylethylazanium |
| 7017976 |
[(1R,2S,4R)-1,7,7-trimethylnorbornan-2-yl]azanium |
| 7019341 |
[4-(2-methylbutan-2-yl)cyclohexyl]azanium |
| 7020627 |
[(1S,5R)-3,3,5-trimethylcyclohexyl]azanium |
| 7020628 |
(1S,5R)-3,3,5-trimethylcyclohexan-1-amine |
| 7021484 |
[(1R,2S,4S)-1,3,3-trimethylnorbornan-2-yl]azanium |
| internal high similarity DBLink | Rows returned: 12 | 1 2 Next >> |
| active | Cluster 15523 | Additional Members: 3 | Rows returned: 0 | |
|