| Compound Information | SONAR Target prediction | 
| Name: | NALBUPHINE HYDROCHLORIDE | 
| Unique Identifier: | SPE01501115 | 
| MolClass: | Checkout models in ver1.5 and ver1.0 | 
| Molecular Formula: |  | 
| Molecular Weight: | 365.682 g/mol | 
| X log p: | 3.008  (online calculus) | 
| Lipinksi Failures | 0 | 
| TPSA | 12.47 | 
| Hydrogen Bond Donor Count: | 0 | 
| Hydrogen Bond Acceptors Count: | 5 | 
| Rotatable Bond Count: | 2 | 
| Canonical Smiles: | Cl.OC1CCC2(O)C3Cc4ccc(O)c5OC1C2(CCN3CC1CCC1)c45 | 
| Source: | synthetic | 
| Therapeutics: | analgesic, narcotic antagonist | 
| Generic_name: | Nalbuphine | 
| Drug_type: | Approved Drug | 
| Pharmgkb_id: | PA450581 | 
| Kegg_compound_id: | C07251 | 
| Drugbank_id: | APRD01132 | 
| Melting_point: | 230 oC as HCl salt | 
| H2o_solubility: | 35.5 mg/mL at 25°C as HCl salt | 
| Logp: | 1.939 | 
| Isoelectric_point: | 8.71 and 9.96 | 
| Cas_registry_number: | 20594-83-6 | 
| Drug_category: | Analgesics, Opioid; Narcotic Antagonists; Narcotics; ATC:N02AF02 | 
| Indication: | For the relief of moderate to severe pain. | 
| Pharmacology: | Nalbuphine is a synthetic opioid agonist-antagonist analgesic of the phenanthrene series. Nalbuphine-s analgesic potency is essentially equivalent to that of morphine
 on a milligram basis. The opioid antagonist activity of nalbuphine is one-fourth as
 potent as nalorphine and 10 times that of pentazocine. Nalbuphine by itself has
 potent opioid antagonist activity at doses equal to or lower than its analgesic
 dose. When administered following or concurrent with mu agonist opioid analgesics
 (e.g., morphine, oxymorphone, fentanyl), nalbuphine may partially reverse or block
 opioid-induced respiratory depression from the mu agonist analgesic. Nalbuphine may
 precipitate withdrawal in patients dependent on opioid drugs. Nalbuphine should be
 used with caution in patients who have been receiving mu opioid analgesics on a
 regular basis.
 | 
| Mechanism_of_action: | Receptor studies show that nalbuphine exerts its action via binding to mu, kappa, and delta receptors, but not to sigma receptors. Nalbuphine is primarily a kappa
 agonist/partial mu antagonist analgesic.
 | 
| Organisms_affected: | Humans and other mammals |