| Compound Information | SONAR Target prediction |
| Name: | PIMETHIXENE MALEATE |
| Unique Identifier: | SPE01501114 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 386.316 g/mol |
| X log p: | 17.187 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 28.54 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 1 |
| Rotatable Bond Count: | 0 |
| Canonical Smiles: | CN1CCC(CC1)=C1c2ccccc2Sc2ccccc21.OC(=O)C=CC(O)=O |
| Source: | synthetic; BP-400 |
| Therapeutics: | H1 antihistamine |
| Found: 15 active | as graph: single | with analogs | << Back 1 2 3 4 5 6 7 8 9 10 Next >> |
| Species: | 4932 |
| Condition: | SPE01503640 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6083±0.00339411 |
| Normalized OD Score: sc h | 1.1034±0.0115597 |
| Z-Score: | 4.9163±0.261935 |
| p-Value: | 0.00000128543 |
| Z-Factor: | -0.788202 |
| Fitness Defect: | 13.5644 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 1 |
| 5702167 | but-2-enedioic acid; 1-methyl-4-thioxanthen-9-ylidene-piperidine |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 4311 | Additional Members: 10 | Rows returned: 1 |
| SPE01505003 | 0.46875 |
Service provided by the
Mike Tyers Laboratory