Compound Information | SONAR Target prediction | Name: | ETHAVERINE HYDROCHLORIDE | Unique Identifier: | SPE01501000 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 401.714 g/mol | X log p: | 15.917 (online calculus) | Lipinksi Failures | 1 | TPSA | 49.28 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 10 | Canonical Smiles: | Cl.CCOc1ccc(Cc2nccc3cc(OCC)c(OCC)cc23)cc1OCC | Source: | synthetic | Therapeutics: | antispasmodic |
Species: |
4932 |
Condition: |
SPE01500325 |
Replicates: |
2 |
Raw OD Value: r im |
0.0483±0 |
Normalized OD Score: sc h |
0.0721±0 |
Z-Score: |
-27.9639±0 |
p-Value: |
0 |
Z-Factor: |
0.907106 |
Fitness Defect: |
INF |
Bioactivity Statement: |
Toxic |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 2|C5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 0.00 Celcius | Date: | 2006-08-13 YYYY-MM-DD | Plate CH Control (+): | 0.0397±0.00444 | Plate DMSO Control (-): | 0.67035±0.01920 | Plate Z-Factor: | 0.8868 |
| png ps pdf |
DBLink | Rows returned: 2 | |
3280 |
1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxy-isoquinoline |
5702159 |
1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxy-isoquinoline hydrochloride |
internal high similarity DBLink | Rows returned: 3 | |
nonactive | Cluster 1145 | Additional Members: 7 | Rows returned: 4 | |
|