Compound Information | SONAR Target prediction | Name: | ETHAVERINE HYDROCHLORIDE | Unique Identifier: | SPE01501000 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 401.714 g/mol | X log p: | 15.917 (online calculus) | Lipinksi Failures | 1 | TPSA | 49.28 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 10 | Canonical Smiles: | Cl.CCOc1ccc(Cc2nccc3cc(OCC)c(OCC)cc23)cc1OCC | Source: | synthetic | Therapeutics: | antispasmodic |
Species: |
4932 |
Condition: |
BY4741 |
Replicates: |
2 |
Raw OD Value: r im |
0.7705±0.00898026 |
Normalized OD Score: sc h |
0.9502±0.00187894 |
Z-Score: |
-1.5726±0.176004 |
p-Value: |
0.118631 |
Z-Factor: |
-0.618196 |
Fitness Defect: |
2.1317 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 24|C7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2010-08-10 YYYY-MM-DD | Plate CH Control (+): | 0.09499999999999999±0.00667 | Plate DMSO Control (-): | 0.9619999999999999±0.01972 | Plate Z-Factor: | 0.8845 |
| png ps pdf |
DBLink | Rows returned: 2 | |
3280 |
1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxy-isoquinoline |
5702159 |
1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxy-isoquinoline hydrochloride |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 1145 | Additional Members: 7 | Rows returned: 1 | |
|