Compound Information | SONAR Target prediction | Name: | ETHAVERINE HYDROCHLORIDE | Unique Identifier: | SPE01501000 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 401.714 g/mol | X log p: | 15.917 (online calculus) | Lipinksi Failures | 1 | TPSA | 49.28 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 10 | Canonical Smiles: | Cl.CCOc1ccc(Cc2nccc3cc(OCC)c(OCC)cc23)cc1OCC | Source: | synthetic | Therapeutics: | antispasmodic |
Species: |
4932 |
Condition: |
SMI1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5879±0.00735391 |
Normalized OD Score: sc h |
0.9104±0.00600748 |
Z-Score: |
-1.8948±0.287139 |
p-Value: |
0.0633096 |
Z-Factor: |
-1.47203 |
Fitness Defect: |
2.7597 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 18|G3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.90 Celcius | Date: | 2005-12-20 YYYY-MM-DD | Plate CH Control (+): | 0.038675±0.00268 | Plate DMSO Control (-): | 0.6406000000000001±0.03097 | Plate Z-Factor: | 0.8696 |
| png ps pdf |
DBLink | Rows returned: 2 | |
3280 |
1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxy-isoquinoline |
5702159 |
1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxy-isoquinoline hydrochloride |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 1145 | Additional Members: 7 | Rows returned: 1 | |
|